C16H16Cl2O3 — CID 63045810
2-(3,4-dichlorophenyl)-1-(2,6-dimethoxyphenyl)ethanol (PubChem CID 63045810) has the molecular formula C16H16Cl2O3 and a molecular weight of 327.21 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-1-(2,6-dimethoxyphenyl)ethanol.
| Compound Name | 2-(3,4-dichlorophenyl)-1-(2,6-dimethoxyphenyl)ethanol |
|---|---|
| PubChem CID | 63045810 |
| Molecular Formula | C16H16Cl2O3 |
| Molecular Weight | 327.21 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-1-(2,6-dimethoxyphenyl)ethanol |
| SMILES | COc1cccc(OC)c1C(O)Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C16H16Cl2O3/c1-20-14-4-3-5-15(21-2)16(14)13(19)9-10-6-7-11(17)12(18)8-10/h3-8,13,19H,9H2,1-2H3 |
| InChIKey | SIWTYBRVUVRWMW-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.21 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |