C13H12Cl2N2O2 — CID 103373604
2-(3,4-dichlorophenyl)-1-(6-methoxypyridazin-3-yl)ethanol (PubChem CID 103373604) has the molecular formula C13H12Cl2N2O2 and a molecular weight of 299.16 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)-1-(6-methoxypyridazin-3-yl)ethanol.
| Compound Name | 2-(3,4-dichlorophenyl)-1-(6-methoxypyridazin-3-yl)ethanol |
|---|---|
| PubChem CID | 103373604 |
| Molecular Formula | C13H12Cl2N2O2 |
| Molecular Weight | 299.16 g/mol |
| Exact Mass | 298.03 |
| IUPAC Name | 2-(3,4-dichlorophenyl)-1-(6-methoxypyridazin-3-yl)ethanol |
| SMILES | COc1ccc(C(O)Cc2ccc(Cl)c(Cl)c2)nn1 |
| InChI | InChI=1S/C13H12Cl2N2O2/c1-19-13-5-4-11(16-17-13)12(18)7-8-2-3-9(14)10(15)6-8/h2-6,12,18H,7H2,1H3 |
| InChIKey | LHMOUBWRXKRGQD-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.16 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |