C18H19Cl2NO3 — CID 8025380
N-[(1R)-1-(3,4-dichlorophenyl)ethyl]-2-(3,4-dimethoxyphenyl)acetamide (PubChem CID 8025380) has the molecular formula C18H19Cl2NO3 and a molecular weight of 368.26 g/mol. Its IUPAC name is N-[(1R)-1-(3,4-dichlorophenyl)ethyl]-2-(3,4-dimethoxyphenyl)acetamide.
| Compound Name | N-[(1R)-1-(3,4-dichlorophenyl)ethyl]-2-(3,4-dimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 8025380 |
| Molecular Formula | C18H19Cl2NO3 |
| Molecular Weight | 368.26 g/mol |
| Exact Mass | 367.07 |
| IUPAC Name | N-[(1R)-1-(3,4-dichlorophenyl)ethyl]-2-(3,4-dimethoxyphenyl)acetamide |
| SMILES | COc1ccc(CC(=O)N[C@H](C)c2ccc(Cl)c(Cl)c2)cc1OC |
| InChI | InChI=1S/C18H19Cl2NO3/c1-11(13-5-6-14(19)15(20)10-13)21-18(22)9-12-4-7-16(23-2)17(8-12)24-3/h4-8,10-11H,9H2,1-3H3,(H,21,22)/t11-/m1/s1 |
| InChIKey | RDBSSJQWTZMZGU-LLVKDONJSA-N |
| XLogP | 4.43 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.26 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |