C16H14BrCl2NO — CID 7948932
N-[(1S)-1-(4-bromophenyl)ethyl]-2-(3,4-dichlorophenyl)acetamide (PubChem CID 7948932) has the molecular formula C16H14BrCl2NO and a molecular weight of 387.10 g/mol. Its IUPAC name is N-[(1S)-1-(4-bromophenyl)ethyl]-2-(3,4-dichlorophenyl)acetamide.
| Compound Name | N-[(1S)-1-(4-bromophenyl)ethyl]-2-(3,4-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 7948932 |
| Molecular Formula | C16H14BrCl2NO |
| Molecular Weight | 387.10 g/mol |
| Exact Mass | 384.96 |
| IUPAC Name | N-[(1S)-1-(4-bromophenyl)ethyl]-2-(3,4-dichlorophenyl)acetamide |
| SMILES | C[C@H](NC(=O)Cc1ccc(Cl)c(Cl)c1)c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H14BrCl2NO/c1-10(12-3-5-13(17)6-4-12)20-16(21)9-11-2-7-14(18)15(19)8-11/h2-8,10H,9H2,1H3,(H,20,21)/t10-/m0/s1 |
| InChIKey | JQKISFSHDNPNEI-JTQLQIEISA-N |
| XLogP | 5.18 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.10 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |