C13H20O3 — CID 58450006
1-(3,4-dimethoxyphenyl)-3-methylbutan-1-ol (PubChem CID 58450006) has the molecular formula C13H20O3 and a molecular weight of 224.30 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-3-methylbutan-1-ol.
| Compound Name | 1-(3,4-dimethoxyphenyl)-3-methylbutan-1-ol |
|---|---|
| PubChem CID | 58450006 |
| Molecular Formula | C13H20O3 |
| Molecular Weight | 224.30 g/mol |
| Exact Mass | 224.14 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-3-methylbutan-1-ol |
| SMILES | COc1ccc(C(O)CC(C)C)cc1OC |
| InChI | InChI=1S/C13H20O3/c1-9(2)7-11(14)10-5-6-12(15-3)13(8-10)16-4/h5-6,8-9,11,14H,7H2,1-4H3 |
| InChIKey | NUZVPIGQLVJYHT-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.30 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |