C19H23FO — CID 63426002
2-(4-fluorophenyl)-1-(2,3,4,5,6-pentamethylphenyl)ethanol (PubChem CID 63426002) has the molecular formula C19H23FO and a molecular weight of 286.39 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-1-(2,3,4,5,6-pentamethylphenyl)ethanol.
| Compound Name | 2-(4-fluorophenyl)-1-(2,3,4,5,6-pentamethylphenyl)ethanol |
|---|---|
| PubChem CID | 63426002 |
| Molecular Formula | C19H23FO |
| Molecular Weight | 286.39 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 2-(4-fluorophenyl)-1-(2,3,4,5,6-pentamethylphenyl)ethanol |
| SMILES | Cc1c(C)c(C)c(C(O)Cc2ccc(F)cc2)c(C)c1C |
| InChI | InChI=1S/C19H23FO/c1-11-12(2)14(4)19(15(5)13(11)3)18(21)10-16-6-8-17(20)9-7-16/h6-9,18,21H,10H2,1-5H3 |
| InChIKey | GKGOAWKAHLHULH-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.39 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |