C18H22O — CID 63899918
2-(3,5-dimethylphenyl)-1-(2-ethylphenyl)ethanol (PubChem CID 63899918) has the molecular formula C18H22O and a molecular weight of 254.37 g/mol. Its IUPAC name is 2-(3,5-dimethylphenyl)-1-(2-ethylphenyl)ethanol.
| Compound Name | 2-(3,5-dimethylphenyl)-1-(2-ethylphenyl)ethanol |
|---|---|
| PubChem CID | 63899918 |
| Molecular Formula | C18H22O |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | 2-(3,5-dimethylphenyl)-1-(2-ethylphenyl)ethanol |
| SMILES | CCc1ccccc1C(O)Cc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C18H22O/c1-4-16-7-5-6-8-17(16)18(19)12-15-10-13(2)9-14(3)11-15/h5-11,18-19H,4,12H2,1-3H3 |
| InChIKey | YNVYXZDIESRNDQ-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |