C30H36 — CID 165102980
bis(1-ethyl-3,5-dimethylbenzene);naphthalene (PubChem CID 165102980) has the molecular formula C30H36 and a molecular weight of 396.62 g/mol. Its IUPAC name is bis(1-ethyl-3,5-dimethylbenzene);naphthalene.
| Compound Name | bis(1-ethyl-3,5-dimethylbenzene);naphthalene |
|---|---|
| PubChem CID | 165102980 |
| Molecular Formula | C30H36 |
| Molecular Weight | 396.62 g/mol |
| Exact Mass | 396.28 |
| IUPAC Name | bis(1-ethyl-3,5-dimethylbenzene);naphthalene |
| SMILES | CCc1cc(C)cc(C)c1.CCc1cc(C)cc(C)c1.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.2C10H14/c1-2-6-10-8-4-3-7-9(10)5-1;2*1-4-10-6-8(2)5-9(3)7-10/h1-8H;2*5-7H,4H2,1-3H3 |
| InChIKey | YQMSLKJEESUKOH-UHFFFAOYSA-N |
| XLogP | 8.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.62 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |