About naphthalene;bis(1,3,5-trimethylbenzene)
naphthalene;bis(1,3,5-trimethylbenzene) (PubChem CID 158615214) has the molecular formula C28H32
and a molecular weight of 368.56 g/mol. Its IUPAC name is naphthalene;bis(1,3,5-trimethylbenzene).
Molecular Properties
| Compound Name | naphthalene;bis(1,3,5-trimethylbenzene) |
| PubChem CID | 158615214 |
| Molecular Formula | C28H32 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.25 |
| IUPAC Name | naphthalene;bis(1,3,5-trimethylbenzene) |
| SMILES | Cc1cc(C)cc(C)c1.Cc1cc(C)cc(C)c1.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.2C9H12/c1-2-6-10-8-4-3-7-9(10)5-1;2*1-7-4-8(2)6-9(3)5-7/h1-8H;2*4-6H,1-3H3 |
| InChIKey | HXHONUVFBKTNGE-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze naphthalene;bis(1,3,5-trimethylbenzene) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalene;bis(1,3,5-trimethylbenzene)?
The IUPAC name of naphthalene;bis(1,3,5-trimethylbenzene) (CID 158615214) is naphthalene;bis(1,3,5-trimethylbenzene).
What is the SMILES notation for naphthalene;bis(1,3,5-trimethylbenzene)?
The canonical SMILES for naphthalene;bis(1,3,5-trimethylbenzene) is Cc1cc(C)cc(C)c1.Cc1cc(C)cc(C)c1.c1ccc2ccccc2c1.
What is the InChIKey of naphthalene;bis(1,3,5-trimethylbenzene)?
The InChIKey is HXHONUVFBKTNGE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8.2C9H12/c1-2-6-10-8-4-3-7-9(10)5-1;2*1-7-4-8(2)6-9(3)5-7/h1-8H;2*4-6H,1-3H3.
What are the key properties of naphthalene;bis(1,3,5-trimethylbenzene)?
naphthalene;bis(1,3,5-trimethylbenzene) has a molecular weight of 368.56 g/mol, XLogP of 8.06, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalene;bis(1,3,5-trimethylbenzene) is sourced from PubChem (CID 158615214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).