C28H32 — CID 158615214
naphthalene;bis(1,3,5-trimethylbenzene) (PubChem CID 158615214) has the molecular formula C28H32 and a molecular weight of 368.56 g/mol. Its IUPAC name is naphthalene;bis(1,3,5-trimethylbenzene).
| Compound Name | naphthalene;bis(1,3,5-trimethylbenzene) |
|---|---|
| PubChem CID | 158615214 |
| Molecular Formula | C28H32 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.25 |
| IUPAC Name | naphthalene;bis(1,3,5-trimethylbenzene) |
| SMILES | Cc1cc(C)cc(C)c1.Cc1cc(C)cc(C)c1.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C10H8.2C9H12/c1-2-6-10-8-4-3-7-9(10)5-1;2*1-7-4-8(2)6-9(3)5-7/h1-8H;2*4-6H,1-3H3 |
| InChIKey | HXHONUVFBKTNGE-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |