C23H22 — CID 158480305
2,6-dimethylnaphthalene;2-methylnaphthalene (PubChem CID 158480305) has the molecular formula C23H22 and a molecular weight of 298.43 g/mol. Its IUPAC name is 2,6-dimethylnaphthalene;2-methylnaphthalene.
| Compound Name | 2,6-dimethylnaphthalene;2-methylnaphthalene |
|---|---|
| PubChem CID | 158480305 |
| Molecular Formula | C23H22 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.17 |
| IUPAC Name | 2,6-dimethylnaphthalene;2-methylnaphthalene |
| SMILES | Cc1ccc2cc(C)ccc2c1.Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C12H12.C11H10/c1-9-3-5-12-8-10(2)4-6-11(12)7-9;1-9-6-7-10-4-2-3-5-11(10)8-9/h3-8H,1-2H3;2-8H,1H3 |
| InChIKey | HHLDGOGJIKPJFU-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |