C17H18N2 — CID 142090044
2,3-dimethylpyrazine;2-methylnaphthalene (PubChem CID 142090044) has the molecular formula C17H18N2 and a molecular weight of 250.34 g/mol. Its IUPAC name is 2,3-dimethylpyrazine;2-methylnaphthalene.
| Compound Name | 2,3-dimethylpyrazine;2-methylnaphthalene |
|---|---|
| PubChem CID | 142090044 |
| Molecular Formula | C17H18N2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 2,3-dimethylpyrazine;2-methylnaphthalene |
| SMILES | Cc1ccc2ccccc2c1.Cc1nccnc1C |
| InChI | InChI=1S/C11H10.C6H8N2/c1-9-6-7-10-4-2-3-5-11(10)8-9;1-5-6(2)8-4-3-7-5/h2-8H,1H3;3-4H,1-2H3 |
| InChIKey | OIOLQWHJMGAWNE-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |