C19H20 — CID 142041411
2-methylnaphthalene;1,2-xylene (PubChem CID 142041411) has the molecular formula C19H20 and a molecular weight of 248.37 g/mol. Its IUPAC name is 2-methylnaphthalene;1,2-xylene.
| Compound Name | 2-methylnaphthalene;1,2-xylene |
|---|---|
| PubChem CID | 142041411 |
| Molecular Formula | C19H20 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | 2-methylnaphthalene;1,2-xylene |
| SMILES | Cc1ccc2ccccc2c1.Cc1ccccc1C |
| InChI | InChI=1S/C11H10.C8H10/c1-9-6-7-10-4-2-3-5-11(10)8-9;1-7-5-3-4-6-8(7)2/h2-8H,1H3;3-6H,1-2H3 |
| InChIKey | YSXYGOCMMKUHPE-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |