About 2-methylnaphthalene;pyrrolidine
2-methylnaphthalene;pyrrolidine (PubChem CID 142171298) has the molecular formula C15H19N
and a molecular weight of 213.32 g/mol. Its IUPAC name is 2-methylnaphthalene;pyrrolidine.
Molecular Properties
| Compound Name | 2-methylnaphthalene;pyrrolidine |
| PubChem CID | 142171298 |
| Molecular Formula | C15H19N |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | 2-methylnaphthalene;pyrrolidine |
| SMILES | C1CCNC1.Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C11H10.C4H9N/c1-9-6-7-10-4-2-3-5-11(10)8-9;1-2-4-5-3-1/h2-8H,1H3;5H,1-4H2 |
| InChIKey | CPZSYZLEOOCUNU-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-methylnaphthalene;pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylnaphthalene;pyrrolidine?
The IUPAC name of 2-methylnaphthalene;pyrrolidine (CID 142171298) is 2-methylnaphthalene;pyrrolidine.
What is the SMILES notation for 2-methylnaphthalene;pyrrolidine?
The canonical SMILES for 2-methylnaphthalene;pyrrolidine is C1CCNC1.Cc1ccc2ccccc2c1.
What is the InChIKey of 2-methylnaphthalene;pyrrolidine?
The InChIKey is CPZSYZLEOOCUNU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10.C4H9N/c1-9-6-7-10-4-2-3-5-11(10)8-9;1-2-4-5-3-1/h2-8H,1H3;5H,1-4H2.
What are the key properties of 2-methylnaphthalene;pyrrolidine?
2-methylnaphthalene;pyrrolidine has a molecular weight of 213.32 g/mol, XLogP of 3.52, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylnaphthalene;pyrrolidine is sourced from PubChem (CID 142171298), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).