About 9-methylanthracene;2-methylnaphthalene
9-methylanthracene;2-methylnaphthalene (PubChem CID 159699144) has the molecular formula C26H22
and a molecular weight of 334.46 g/mol. Its IUPAC name is 9-methylanthracene;2-methylnaphthalene.
Molecular Properties
| Compound Name | 9-methylanthracene;2-methylnaphthalene |
| PubChem CID | 159699144 |
| Molecular Formula | C26H22 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.17 |
| IUPAC Name | 9-methylanthracene;2-methylnaphthalene |
| SMILES | Cc1c2ccccc2cc2ccccc12.Cc1ccc2ccccc2c1 |
| InChI | InChI=1S/C15H12.C11H10/c1-11-14-8-4-2-6-12(14)10-13-7-3-5-9-15(11)13;1-9-6-7-10-4-2-3-5-11(10)8-9/h2-10H,1H3;2-8H,1H3 |
| InChIKey | MXJZJGZJGWXSDG-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 9-methylanthracene;2-methylnaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methylanthracene;2-methylnaphthalene?
The IUPAC name of 9-methylanthracene;2-methylnaphthalene (CID 159699144) is 9-methylanthracene;2-methylnaphthalene.
What is the SMILES notation for 9-methylanthracene;2-methylnaphthalene?
The canonical SMILES for 9-methylanthracene;2-methylnaphthalene is Cc1c2ccccc2cc2ccccc12.Cc1ccc2ccccc2c1.
What is the InChIKey of 9-methylanthracene;2-methylnaphthalene?
The InChIKey is MXJZJGZJGWXSDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12.C11H10/c1-11-14-8-4-2-6-12(14)10-13-7-3-5-9-15(11)13;1-9-6-7-10-4-2-3-5-11(10)8-9/h2-10H,1H3;2-8H,1H3.
What are the key properties of 9-methylanthracene;2-methylnaphthalene?
9-methylanthracene;2-methylnaphthalene has a molecular weight of 334.46 g/mol, XLogP of 7.45, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methylanthracene;2-methylnaphthalene is sourced from PubChem (CID 159699144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).