About ethane;9-methylanthracene;naphthalene
ethane;9-methylanthracene;naphthalene (PubChem CID 161226057) has the molecular formula C27H26
and a molecular weight of 350.51 g/mol. Its IUPAC name is ethane;9-methylanthracene;naphthalene.
Molecular Properties
| Compound Name | ethane;9-methylanthracene;naphthalene |
| PubChem CID | 161226057 |
| Molecular Formula | C27H26 |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | ethane;9-methylanthracene;naphthalene |
| SMILES | CC.Cc1c2ccccc2cc2ccccc12.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C15H12.C10H8.C2H6/c1-11-14-8-4-2-6-12(14)10-13-7-3-5-9-15(11)13;1-2-6-10-8-4-3-7-9(10)5-1;1-2/h2-10H,1H3;1-8H;1-2H3 |
| InChIKey | UYDGSDIULLVBBK-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze ethane;9-methylanthracene;naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;9-methylanthracene;naphthalene?
The IUPAC name of ethane;9-methylanthracene;naphthalene (CID 161226057) is ethane;9-methylanthracene;naphthalene.
What is the SMILES notation for ethane;9-methylanthracene;naphthalene?
The canonical SMILES for ethane;9-methylanthracene;naphthalene is CC.Cc1c2ccccc2cc2ccccc12.c1ccc2ccccc2c1.
What is the InChIKey of ethane;9-methylanthracene;naphthalene?
The InChIKey is UYDGSDIULLVBBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12.C10H8.C2H6/c1-11-14-8-4-2-6-12(14)10-13-7-3-5-9-15(11)13;1-2-6-10-8-4-3-7-9(10)5-1;1-2/h2-10H,1H3;1-8H;1-2H3.
What are the key properties of ethane;9-methylanthracene;naphthalene?
ethane;9-methylanthracene;naphthalene has a molecular weight of 350.51 g/mol, XLogP of 8.17, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;9-methylanthracene;naphthalene is sourced from PubChem (CID 161226057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).