About 9-methylanthracene;naphthalene
9-methylanthracene;naphthalene (PubChem CID 142881908) has the molecular formula C25H20
and a molecular weight of 320.44 g/mol. Its IUPAC name is 9-methylanthracene;naphthalene.
Molecular Properties
| Compound Name | 9-methylanthracene;naphthalene |
| PubChem CID | 142881908 |
| Molecular Formula | C25H20 |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 9-methylanthracene;naphthalene |
| SMILES | Cc1c2ccccc2cc2ccccc12.c1ccc2ccccc2c1 |
| InChI | InChI=1S/C15H12.C10H8/c1-11-14-8-4-2-6-12(14)10-13-7-3-5-9-15(11)13;1-2-6-10-8-4-3-7-9(10)5-1/h2-10H,1H3;1-8H |
| InChIKey | FMOZBUBLNSBEEE-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 9-methylanthracene;naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methylanthracene;naphthalene?
The IUPAC name of 9-methylanthracene;naphthalene (CID 142881908) is 9-methylanthracene;naphthalene.
What is the SMILES notation for 9-methylanthracene;naphthalene?
The canonical SMILES for 9-methylanthracene;naphthalene is Cc1c2ccccc2cc2ccccc12.c1ccc2ccccc2c1.
What is the InChIKey of 9-methylanthracene;naphthalene?
The InChIKey is FMOZBUBLNSBEEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12.C10H8/c1-11-14-8-4-2-6-12(14)10-13-7-3-5-9-15(11)13;1-2-6-10-8-4-3-7-9(10)5-1/h2-10H,1H3;1-8H.
What are the key properties of 9-methylanthracene;naphthalene?
9-methylanthracene;naphthalene has a molecular weight of 320.44 g/mol, XLogP of 7.14, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methylanthracene;naphthalene is sourced from PubChem (CID 142881908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).