About 2,10-dimethylanthracene;formaldehyde
2,10-dimethylanthracene;formaldehyde (PubChem CID 169199000) has the molecular formula C17H16O
and a molecular weight of 236.31 g/mol. Its IUPAC name is 2,10-dimethylanthracene;formaldehyde.
Molecular Properties
| Compound Name | 2,10-dimethylanthracene;formaldehyde |
| PubChem CID | 169199000 |
| Molecular Formula | C17H16O |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.12 |
| IUPAC Name | 2,10-dimethylanthracene;formaldehyde |
| SMILES | C=O.Cc1ccc2c(C)c3ccccc3cc2c1 |
| InChI | InChI=1S/C16H14.CH2O/c1-11-7-8-16-12(2)15-6-4-3-5-13(15)10-14(16)9-11;1-2/h3-10H,1-2H3;1H2 |
| InChIKey | NSYYGNUVGKEBDZ-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 2,10-dimethylanthracene;formaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,10-dimethylanthracene;formaldehyde?
The IUPAC name of 2,10-dimethylanthracene;formaldehyde (CID 169199000) is 2,10-dimethylanthracene;formaldehyde.
What is the SMILES notation for 2,10-dimethylanthracene;formaldehyde?
The canonical SMILES for 2,10-dimethylanthracene;formaldehyde is C=O.Cc1ccc2c(C)c3ccccc3cc2c1.
What is the InChIKey of 2,10-dimethylanthracene;formaldehyde?
The InChIKey is NSYYGNUVGKEBDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14.CH2O/c1-11-7-8-16-12(2)15-6-4-3-5-13(15)10-14(16)9-11;1-2/h3-10H,1-2H3;1H2.
What are the key properties of 2,10-dimethylanthracene;formaldehyde?
2,10-dimethylanthracene;formaldehyde has a molecular weight of 236.31 g/mol, XLogP of 4.42, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,10-dimethylanthracene;formaldehyde is sourced from PubChem (CID 169199000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).