C89H76 — CID 158097915
2-methylanthracene;9-methylanthracene;1-methylnaphthalene;2-methylnaphthalene;2-methylphenanthrene;9-methylphenanthrene;toluene (PubChem CID 158097915) has the molecular formula C89H76 and a molecular weight of 1145.59 g/mol. Its IUPAC name is 2-methylanthracene;9-methylanthracene;1-methylnaphthalene;2-methylnaphthalene;2-methylphenanthrene;9-methylphenanthrene;toluene.
| Compound Name | 2-methylanthracene;9-methylanthracene;1-methylnaphthalene;2-methylnaphthalene;2-methylphenanthrene;9-methylphenanthrene;toluene |
|---|---|
| PubChem CID | 158097915 |
| Molecular Formula | C89H76 |
| Molecular Weight | 1145.59 g/mol |
| Exact Mass | 1144.59 |
| IUPAC Name | 2-methylanthracene;9-methylanthracene;1-methylnaphthalene;2-methylnaphthalene;2-methylphenanthrene;9-methylphenanthrene;toluene |
| SMILES | Cc1c2ccccc2cc2ccccc12.Cc1cc2ccccc2c2ccccc12.Cc1ccc2c(ccc3ccccc32)c1.Cc1ccc2cc3ccccc3cc2c1.Cc1ccc2ccccc2c1.Cc1cccc2ccccc12.Cc1ccccc1 |
| InChI | InChI=1S/4C15H12.2C11H10.C7H8/c1-11-14-8-4-2-6-12(14)10-13-7-3-5-9-15(11)13;1-11-10-12-6-2-3-8-14(12)15-9-5-4-7-13(11)15;1-11-6-9-15-13(10-11)8-7-12-4-2-3-5-14(12)15;1-11-6-7-14-9-12-4-2-3-5-13(12)10-15(14)8-11;1-9-5-4-7-10-6-2-3-8-11(9)10;1-9-6-7-10-4-2-3-5-11(10)8-9;1-7-5-3-2-4-6-7/h4*2-10H,1H3;2*2-8H,1H3;2-6H,1H3 |
| InChIKey | FOWUURXXKDWBFS-UHFFFAOYSA-N |
| XLogP | 25.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 89 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1145.59 |
| LogP ≤ 5 | 25.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|