C76H80 — CID 162002559
1,3-dimethylnaphthalene;1,4-dimethylnaphthalene;1,5-dimethylnaphthalene;1,6-dimethylnaphthalene;1,7-dimethylnaphthalene;1,3-xylene;1,4-xylene (PubChem CID 162002559) has the molecular formula C76H80 and a molecular weight of 993.48 g/mol. Its IUPAC name is 1,3-dimethylnaphthalene;1,4-dimethylnaphthalene;1,5-dimethylnaphthalene;1,6-dimethylnaphthalene;1,7-dimethylnaphthalene;1,3-xylene;1,4-xylene.
| Compound Name | 1,3-dimethylnaphthalene;1,4-dimethylnaphthalene;1,5-dimethylnaphthalene;1,6-dimethylnaphthalene;1,7-dimethylnaphthalene;1,3-xylene;1,4-xylene |
|---|---|
| PubChem CID | 162002559 |
| Molecular Formula | C76H80 |
| Molecular Weight | 993.48 g/mol |
| Exact Mass | 992.63 |
| IUPAC Name | 1,3-dimethylnaphthalene;1,4-dimethylnaphthalene;1,5-dimethylnaphthalene;1,6-dimethylnaphthalene;1,7-dimethylnaphthalene;1,3-xylene;1,4-xylene |
| SMILES | Cc1cc(C)c2ccccc2c1.Cc1ccc(C)c2ccccc12.Cc1ccc(C)cc1.Cc1ccc2c(C)cccc2c1.Cc1ccc2cccc(C)c2c1.Cc1cccc(C)c1.Cc1cccc2c(C)cccc12 |
| InChI | InChI=1S/5C12H12.2C8H10/c1-9-5-3-8-12-10(2)6-4-7-11(9)12;1-9-6-7-12-10(2)4-3-5-11(12)8-9;1-9-6-7-11-5-3-4-10(2)12(11)8-9;1-9-7-10(2)12-6-4-3-5-11(12)8-9;1-9-7-8-10(2)12-6-4-3-5-11(9)12;1-7-3-5-8(2)6-4-7;1-7-4-3-5-8(2)6-7/h5*3-8H,1-2H3;2*3-6H,1-2H3 |
| InChIKey | YSKFKXKDWTTWFI-UHFFFAOYSA-N |
| XLogP | 21.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 76 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 993.48 |
| LogP ≤ 5 | 21.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |