C86H120 — CID 158627561
1,3-dimethylnaphthalene;1,4-dimethylnaphthalene;1,5-dimethylnaphthalene;2,6-dimethylnaphthalene;ethane;1,2-xylene;1,3-xylene;1,4-xylene (PubChem CID 158627561) has the molecular formula C86H120 and a molecular weight of 1153.91 g/mol. Its IUPAC name is 1,3-dimethylnaphthalene;1,4-dimethylnaphthalene;1,5-dimethylnaphthalene;2,6-dimethylnaphthalene;ethane;1,2-xylene;1,3-xylene;1,4-xylene.
| Compound Name | 1,3-dimethylnaphthalene;1,4-dimethylnaphthalene;1,5-dimethylnaphthalene;2,6-dimethylnaphthalene;ethane;1,2-xylene;1,3-xylene;1,4-xylene |
|---|---|
| PubChem CID | 158627561 |
| Molecular Formula | C86H120 |
| Molecular Weight | 1153.91 g/mol |
| Exact Mass | 1152.94 |
| IUPAC Name | 1,3-dimethylnaphthalene;1,4-dimethylnaphthalene;1,5-dimethylnaphthalene;2,6-dimethylnaphthalene;ethane;1,2-xylene;1,3-xylene;1,4-xylene |
| SMILES | CC.CC.CC.CC.CC.CC.CC.Cc1cc(C)c2ccccc2c1.Cc1ccc(C)c2ccccc12.Cc1ccc(C)cc1.Cc1ccc2cc(C)ccc2c1.Cc1cccc(C)c1.Cc1cccc2c(C)cccc12.Cc1ccccc1C |
| InChI | InChI=1S/4C12H12.3C8H10.7C2H6/c1-9-3-5-12-8-10(2)4-6-11(12)7-9;1-9-5-3-8-12-10(2)6-4-7-11(9)12;1-9-7-10(2)12-6-4-3-5-11(12)8-9;1-9-7-8-10(2)12-6-4-3-5-11(9)12;1-7-3-5-8(2)6-4-7;1-7-4-3-5-8(2)6-7;1-7-5-3-4-6-8(7)2;7*1-2/h4*3-8H,1-2H3;3*3-6H,1-2H3;7*1-2H3 |
| InChIKey | HYTYADKKFAEXDZ-UHFFFAOYSA-N |
| XLogP | 27.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 86 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1153.91 |
| LogP ≤ 5 | 27.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |