C18H30 — CID 145447624
1,3-dimethylnaphthalene;ethane (PubChem CID 145447624) has the molecular formula C18H30 and a molecular weight of 246.44 g/mol. Its IUPAC name is 1,3-dimethylnaphthalene;ethane.
| Compound Name | 1,3-dimethylnaphthalene;ethane |
|---|---|
| PubChem CID | 145447624 |
| Molecular Formula | C18H30 |
| Molecular Weight | 246.44 g/mol |
| Exact Mass | 246.23 |
| IUPAC Name | 1,3-dimethylnaphthalene;ethane |
| SMILES | CC.CC.CC.Cc1cc(C)c2ccccc2c1 |
| InChI | InChI=1S/C12H12.3C2H6/c1-9-7-10(2)12-6-4-3-5-11(12)8-9;3*1-2/h3-8H,1-2H3;3*1-2H3 |
| InChIKey | RNNDMJUDXQHAOW-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.44 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |