About 1,3-dimethylnaphthalene;ethane
1,3-dimethylnaphthalene;ethane (PubChem CID 145447624) has the molecular formula C18H30
and a molecular weight of 246.44 g/mol. Its IUPAC name is 1,3-dimethylnaphthalene;ethane.
Molecular Properties
| Compound Name | 1,3-dimethylnaphthalene;ethane |
| PubChem CID | 145447624 |
| Molecular Formula | C18H30 |
| Molecular Weight | 246.44 g/mol |
| Exact Mass | 246.23 |
| IUPAC Name | 1,3-dimethylnaphthalene;ethane |
| SMILES | CC.CC.CC.Cc1cc(C)c2ccccc2c1 |
| InChI | InChI=1S/C12H12.3C2H6/c1-9-7-10(2)12-6-4-3-5-11(12)8-9;3*1-2/h3-8H,1-2H3;3*1-2H3 |
| InChIKey | RNNDMJUDXQHAOW-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 246.44 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,3-dimethylnaphthalene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethylnaphthalene;ethane?
The IUPAC name of 1,3-dimethylnaphthalene;ethane (CID 145447624) is 1,3-dimethylnaphthalene;ethane.
What is the SMILES notation for 1,3-dimethylnaphthalene;ethane?
The canonical SMILES for 1,3-dimethylnaphthalene;ethane is CC.CC.CC.Cc1cc(C)c2ccccc2c1.
What is the InChIKey of 1,3-dimethylnaphthalene;ethane?
The InChIKey is RNNDMJUDXQHAOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12.3C2H6/c1-9-7-10(2)12-6-4-3-5-11(12)8-9;3*1-2/h3-8H,1-2H3;3*1-2H3.
What are the key properties of 1,3-dimethylnaphthalene;ethane?
1,3-dimethylnaphthalene;ethane has a molecular weight of 246.44 g/mol, XLogP of 6.54, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethylnaphthalene;ethane is sourced from PubChem (CID 145447624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).