About ethane;methane;9-methylphenanthrene
ethane;methane;9-methylphenanthrene (PubChem CID 144916914) has the molecular formula C19H26
and a molecular weight of 254.42 g/mol. Its IUPAC name is ethane;methane;9-methylphenanthrene.
Molecular Properties
| Compound Name | ethane;methane;9-methylphenanthrene |
| PubChem CID | 144916914 |
| Molecular Formula | C19H26 |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.20 |
| IUPAC Name | ethane;methane;9-methylphenanthrene |
| SMILES | C.C.CC.Cc1cc2ccccc2c2ccccc12 |
| InChI | InChI=1S/C15H12.C2H6.2CH4/c1-11-10-12-6-2-3-8-14(12)15-9-5-4-7-13(11)15;1-2;;/h2-10H,1H3;1-2H3;2*1H4 |
| InChIKey | AUHBFXZXWBUOOD-UHFFFAOYSA-N |
| XLogP | 6.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze ethane;methane;9-methylphenanthrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methane;9-methylphenanthrene?
The IUPAC name of ethane;methane;9-methylphenanthrene (CID 144916914) is ethane;methane;9-methylphenanthrene.
What is the SMILES notation for ethane;methane;9-methylphenanthrene?
The canonical SMILES for ethane;methane;9-methylphenanthrene is C.C.CC.Cc1cc2ccccc2c2ccccc12.
What is the InChIKey of ethane;methane;9-methylphenanthrene?
The InChIKey is AUHBFXZXWBUOOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12.C2H6.2CH4/c1-11-10-12-6-2-3-8-14(12)15-9-5-4-7-13(11)15;1-2;;/h2-10H,1H3;1-2H3;2*1H4.
What are the key properties of ethane;methane;9-methylphenanthrene?
ethane;methane;9-methylphenanthrene has a molecular weight of 254.42 g/mol, XLogP of 6.60, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methane;9-methylphenanthrene is sourced from PubChem (CID 144916914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).