About methane;1-methylphenanthrene
methane;1-methylphenanthrene (PubChem CID 175001905) has the molecular formula C16H16
and a molecular weight of 208.30 g/mol. Its IUPAC name is methane;1-methylphenanthrene.
Molecular Properties
| Compound Name | methane;1-methylphenanthrene |
| PubChem CID | 175001905 |
| Molecular Formula | C16H16 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.13 |
| IUPAC Name | methane;1-methylphenanthrene |
| SMILES | C.Cc1cccc2c1ccc1ccccc12 |
| InChI | InChI=1S/C15H12.CH4/c1-11-5-4-8-15-13(11)10-9-12-6-2-3-7-14(12)15;/h2-10H,1H3;1H4 |
| InChIKey | OQZYYZLZOFMGTC-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze methane;1-methylphenanthrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;1-methylphenanthrene?
The IUPAC name of methane;1-methylphenanthrene (CID 175001905) is methane;1-methylphenanthrene.
What is the SMILES notation for methane;1-methylphenanthrene?
The canonical SMILES for methane;1-methylphenanthrene is C.Cc1cccc2c1ccc1ccccc12.
What is the InChIKey of methane;1-methylphenanthrene?
The InChIKey is OQZYYZLZOFMGTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12.CH4/c1-11-5-4-8-15-13(11)10-9-12-6-2-3-7-14(12)15;/h2-10H,1H3;1H4.
What are the key properties of methane;1-methylphenanthrene?
methane;1-methylphenanthrene has a molecular weight of 208.30 g/mol, XLogP of 4.94, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methane;1-methylphenanthrene is sourced from PubChem (CID 175001905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).