C20H26 — CID 144939314
1,6-dimethylphenanthrene;ethane (PubChem CID 144939314) has the molecular formula C20H26 and a molecular weight of 266.43 g/mol. Its IUPAC name is 1,6-dimethylphenanthrene;ethane.
| Compound Name | 1,6-dimethylphenanthrene;ethane |
|---|---|
| PubChem CID | 144939314 |
| Molecular Formula | C20H26 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | 1,6-dimethylphenanthrene;ethane |
| SMILES | CC.CC.Cc1ccc2ccc3c(C)cccc3c2c1 |
| InChI | InChI=1S/C16H14.2C2H6/c1-11-6-7-13-8-9-14-12(2)4-3-5-15(14)16(13)10-11;2*1-2/h3-10H,1-2H3;2*1-2H3 |
| InChIKey | NSHIDPUBZOWUFC-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|