C48H42 — CID 160604246
1,3-dimethylphenanthrene;1,5-dimethylphenanthrene;1,7-dimethylphenanthrene (PubChem CID 160604246) has the molecular formula C48H42 and a molecular weight of 618.86 g/mol. Its IUPAC name is 1,3-dimethylphenanthrene;1,5-dimethylphenanthrene;1,7-dimethylphenanthrene.
| Compound Name | 1,3-dimethylphenanthrene;1,5-dimethylphenanthrene;1,7-dimethylphenanthrene |
|---|---|
| PubChem CID | 160604246 |
| Molecular Formula | C48H42 |
| Molecular Weight | 618.86 g/mol |
| Exact Mass | 618.33 |
| IUPAC Name | 1,3-dimethylphenanthrene;1,5-dimethylphenanthrene;1,7-dimethylphenanthrene |
| SMILES | Cc1cc(C)c2ccc3ccccc3c2c1.Cc1ccc2c(ccc3c(C)cccc32)c1.Cc1cccc2c1ccc1cccc(C)c12 |
| InChI | InChI=1S/3C16H14/c1-11-5-4-8-15-14(11)10-9-13-7-3-6-12(2)16(13)15;1-11-6-8-15-13(10-11)7-9-14-12(2)4-3-5-16(14)15;1-11-9-12(2)14-8-7-13-5-3-4-6-15(13)16(14)10-11/h3*3-10H,1-2H3 |
| InChIKey | REQZXPIRTVHASQ-UHFFFAOYSA-N |
| XLogP | 13.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.86 |
| LogP ≤ 5 | 13.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|