C60H48 — CID 158709590
1-methylphenanthrene;2-methylphenanthrene;3-methylphenanthrene;4-methylphenanthrene (PubChem CID 158709590) has the molecular formula C60H48 and a molecular weight of 769.04 g/mol. Its IUPAC name is 1-methylphenanthrene;2-methylphenanthrene;3-methylphenanthrene;4-methylphenanthrene.
| Compound Name | 1-methylphenanthrene;2-methylphenanthrene;3-methylphenanthrene;4-methylphenanthrene |
|---|---|
| PubChem CID | 158709590 |
| Molecular Formula | C60H48 |
| Molecular Weight | 769.04 g/mol |
| Exact Mass | 768.38 |
| IUPAC Name | 1-methylphenanthrene;2-methylphenanthrene;3-methylphenanthrene;4-methylphenanthrene |
| SMILES | Cc1ccc2c(ccc3ccccc32)c1.Cc1ccc2ccc3ccccc3c2c1.Cc1cccc2c1ccc1ccccc12.Cc1cccc2ccc3ccccc3c12 |
| InChI | InChI=1S/4C15H12/c1-11-5-4-7-13-10-9-12-6-2-3-8-14(12)15(11)13;1-11-5-4-8-15-13(11)10-9-12-6-2-3-7-14(12)15;1-11-6-9-15-13(10-11)8-7-12-4-2-3-5-14(12)15;1-11-6-7-13-9-8-12-4-2-3-5-14(12)15(13)10-11/h4*2-10H,1H3 |
| InChIKey | IIOANXGKKOJPBH-UHFFFAOYSA-N |
| XLogP | 17.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 769.04 |
| LogP ≤ 5 | 17.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|