About acetylene;ethane;1-methylnaphthalene
acetylene;ethane;1-methylnaphthalene (PubChem CID 167495690) has the molecular formula C15H18
and a molecular weight of 198.31 g/mol. Its IUPAC name is acetylene;ethane;1-methylnaphthalene.
Molecular Properties
| Compound Name | acetylene;ethane;1-methylnaphthalene |
| PubChem CID | 167495690 |
| Molecular Formula | C15H18 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | acetylene;ethane;1-methylnaphthalene |
| SMILES | C#C.CC.Cc1cccc2ccccc12 |
| InChI | InChI=1S/C11H10.C2H6.C2H2/c1-9-5-4-7-10-6-2-3-8-11(9)10;2*1-2/h2-8H,1H3;1-2H3;1-2H |
| InChIKey | ICHDVLPDLPTWDS-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze acetylene;ethane;1-methylnaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetylene;ethane;1-methylnaphthalene?
The IUPAC name of acetylene;ethane;1-methylnaphthalene (CID 167495690) is acetylene;ethane;1-methylnaphthalene.
What is the SMILES notation for acetylene;ethane;1-methylnaphthalene?
The canonical SMILES for acetylene;ethane;1-methylnaphthalene is C#C.CC.Cc1cccc2ccccc12.
What is the InChIKey of acetylene;ethane;1-methylnaphthalene?
The InChIKey is ICHDVLPDLPTWDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10.C2H6.C2H2/c1-9-5-4-7-10-6-2-3-8-11(9)10;2*1-2/h2-8H,1H3;1-2H3;1-2H.
What are the key properties of acetylene;ethane;1-methylnaphthalene?
acetylene;ethane;1-methylnaphthalene has a molecular weight of 198.31 g/mol, XLogP of 4.42, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for acetylene;ethane;1-methylnaphthalene is sourced from PubChem (CID 167495690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).