About 1-methylnaphthalene;stilbene
1-methylnaphthalene;stilbene (PubChem CID 173370087) has the molecular formula C25H22
and a molecular weight of 322.45 g/mol. Its IUPAC name is 1-methylnaphthalene;stilbene.
Molecular Properties
| Compound Name | 1-methylnaphthalene;stilbene |
| PubChem CID | 173370087 |
| Molecular Formula | C25H22 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 1-methylnaphthalene;stilbene |
| SMILES | C(=Cc1ccccc1)c1ccccc1.Cc1cccc2ccccc12 |
| InChI | InChI=1S/C14H12.C11H10/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;1-9-5-4-7-10-6-2-3-8-11(9)10/h1-12H;2-8H,1H3 |
| InChIKey | HXIVPWBGUFNTPP-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 1-methylnaphthalene;stilbene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylnaphthalene;stilbene?
The IUPAC name of 1-methylnaphthalene;stilbene (CID 173370087) is 1-methylnaphthalene;stilbene.
What is the SMILES notation for 1-methylnaphthalene;stilbene?
The canonical SMILES for 1-methylnaphthalene;stilbene is C(=Cc1ccccc1)c1ccccc1.Cc1cccc2ccccc12.
What is the InChIKey of 1-methylnaphthalene;stilbene?
The InChIKey is HXIVPWBGUFNTPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12.C11H10/c1-3-7-13(8-4-1)11-12-14-9-5-2-6-10-14;1-9-5-4-7-10-6-2-3-8-11(9)10/h1-12H;2-8H,1H3.
What are the key properties of 1-methylnaphthalene;stilbene?
1-methylnaphthalene;stilbene has a molecular weight of 322.45 g/mol, XLogP of 7.01, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylnaphthalene;stilbene is sourced from PubChem (CID 173370087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).