About 1-methylnaphthalene;[(E)-pent-1-enyl]benzene;pentylbenzene
1-methylnaphthalene;[(E)-pent-1-enyl]benzene;pentylbenzene (PubChem CID 159111653) has the molecular formula C33H40
and a molecular weight of 436.68 g/mol. Its IUPAC name is 1-methylnaphthalene;[(E)-pent-1-enyl]benzene;pentylbenzene.
Molecular Properties
| Compound Name | 1-methylnaphthalene;[(E)-pent-1-enyl]benzene;pentylbenzene |
| PubChem CID | 159111653 |
| Molecular Formula | C33H40 |
| Molecular Weight | 436.68 g/mol |
| Exact Mass | 436.31 |
| IUPAC Name | 1-methylnaphthalene;[(E)-pent-1-enyl]benzene;pentylbenzene |
| SMILES | CCC/C=C/c1ccccc1.CCCCCc1ccccc1.Cc1cccc2ccccc12 |
| InChI | InChI=1S/C11H10.C11H16.C11H14/c1-9-5-4-7-10-6-2-3-8-11(9)10;2*1-2-3-5-8-11-9-6-4-7-10-11/h2-8H,1H3;4,6-7,9-10H,2-3,5,8H2,1H3;4-10H,2-3H2,1H3/b;;8-5+ |
| InChIKey | KEOPHTJYLACMCM-HVUPXCECSA-N |
| XLogP | 10.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 436.68 |
| LogP ≤ 5 | 10.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-methylnaphthalene;[(E)-pent-1-enyl]benzene;pentylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylnaphthalene;[(E)-pent-1-enyl]benzene;pentylbenzene?
The IUPAC name of 1-methylnaphthalene;[(E)-pent-1-enyl]benzene;pentylbenzene (CID 159111653) is 1-methylnaphthalene;[(E)-pent-1-enyl]benzene;pentylbenzene.
What is the SMILES notation for 1-methylnaphthalene;[(E)-pent-1-enyl]benzene;pentylbenzene?
The canonical SMILES for 1-methylnaphthalene;[(E)-pent-1-enyl]benzene;pentylbenzene is CCC/C=C/c1ccccc1.CCCCCc1ccccc1.Cc1cccc2ccccc12.
What is the InChIKey of 1-methylnaphthalene;[(E)-pent-1-enyl]benzene;pentylbenzene?
The InChIKey is KEOPHTJYLACMCM-HVUPXCECSA-N. The full InChI is InChI=1S/C11H10.C11H16.C11H14/c1-9-5-4-7-10-6-2-3-8-11(9)10;2*1-2-3-5-8-11-9-6-4-7-10-11/h2-8H,1H3;4,6-7,9-10H,2-3,5,8H2,1H3;4-10H,2-3H2,1H3/b;;8-5+.
What are the key properties of 1-methylnaphthalene;[(E)-pent-1-enyl]benzene;pentylbenzene?
1-methylnaphthalene;[(E)-pent-1-enyl]benzene;pentylbenzene has a molecular weight of 436.68 g/mol, XLogP of 10.07, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylnaphthalene;[(E)-pent-1-enyl]benzene;pentylbenzene is sourced from PubChem (CID 159111653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).