About ethane;1-methylnaphthalene;toluene
ethane;1-methylnaphthalene;toluene (PubChem CID 91013579) has the molecular formula C27H32
and a molecular weight of 356.55 g/mol. Its IUPAC name is ethane;1-methylnaphthalene;toluene.
Molecular Properties
| Compound Name | ethane;1-methylnaphthalene;toluene |
| PubChem CID | 91013579 |
| Molecular Formula | C27H32 |
| Molecular Weight | 356.55 g/mol |
| Exact Mass | 356.25 |
| IUPAC Name | ethane;1-methylnaphthalene;toluene |
| SMILES | CC.Cc1cccc2ccccc12.Cc1ccccc1.Cc1ccccc1 |
| InChI | InChI=1S/C11H10.2C7H8.C2H6/c1-9-5-4-7-10-6-2-3-8-11(9)10;2*1-7-5-3-2-4-6-7;1-2/h2-8H,1H3;2*2-6H,1H3;1-2H3 |
| InChIKey | YBOYMABAEJMXKO-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 356.55 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze ethane;1-methylnaphthalene;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-methylnaphthalene;toluene?
The IUPAC name of ethane;1-methylnaphthalene;toluene (CID 91013579) is ethane;1-methylnaphthalene;toluene.
What is the SMILES notation for ethane;1-methylnaphthalene;toluene?
The canonical SMILES for ethane;1-methylnaphthalene;toluene is CC.Cc1cccc2ccccc12.Cc1ccccc1.Cc1ccccc1.
What is the InChIKey of ethane;1-methylnaphthalene;toluene?
The InChIKey is YBOYMABAEJMXKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10.2C7H8.C2H6/c1-9-5-4-7-10-6-2-3-8-11(9)10;2*1-7-5-3-2-4-6-7;1-2/h2-8H,1H3;2*2-6H,1H3;1-2H3.
What are the key properties of ethane;1-methylnaphthalene;toluene?
ethane;1-methylnaphthalene;toluene has a molecular weight of 356.55 g/mol, XLogP of 8.16, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-methylnaphthalene;toluene is sourced from PubChem (CID 91013579), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).