About phenanthrene;toluene
phenanthrene;toluene (PubChem CID 158347700) has the molecular formula C21H18
and a molecular weight of 270.38 g/mol. Its IUPAC name is phenanthrene;toluene.
Molecular Properties
| Compound Name | phenanthrene;toluene |
| PubChem CID | 158347700 |
| Molecular Formula | C21H18 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | phenanthrene;toluene |
| SMILES | Cc1ccccc1.c1ccc2c(c1)ccc1ccccc12 |
| InChI | InChI=1S/C14H10.C7H8/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13;1-7-5-3-2-4-6-7/h1-10H;2-6H,1H3 |
| InChIKey | GRXXTGCGWKHSDD-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze phenanthrene;toluene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenanthrene;toluene?
The IUPAC name of phenanthrene;toluene (CID 158347700) is phenanthrene;toluene.
What is the SMILES notation for phenanthrene;toluene?
The canonical SMILES for phenanthrene;toluene is Cc1ccccc1.c1ccc2c(c1)ccc1ccccc12.
What is the InChIKey of phenanthrene;toluene?
The InChIKey is GRXXTGCGWKHSDD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10.C7H8/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13;1-7-5-3-2-4-6-7/h1-10H;2-6H,1H3.
What are the key properties of phenanthrene;toluene?
phenanthrene;toluene has a molecular weight of 270.38 g/mol, XLogP of 5.99, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for phenanthrene;toluene is sourced from PubChem (CID 158347700), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).