About butan-1-amine;1-methylnaphthalene
butan-1-amine;1-methylnaphthalene (PubChem CID 143588906) has the molecular formula C15H21N
and a molecular weight of 215.34 g/mol. Its IUPAC name is butan-1-amine;1-methylnaphthalene.
Molecular Properties
| Compound Name | butan-1-amine;1-methylnaphthalene |
| PubChem CID | 143588906 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | butan-1-amine;1-methylnaphthalene |
| SMILES | CCCCN.Cc1cccc2ccccc12 |
| InChI | InChI=1S/C11H10.C4H11N/c1-9-5-4-7-10-6-2-3-8-11(9)10;1-2-3-4-5/h2-8H,1H3;2-5H2,1H3 |
| InChIKey | NPFJYAMPVZZPHO-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze butan-1-amine;1-methylnaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butan-1-amine;1-methylnaphthalene?
The IUPAC name of butan-1-amine;1-methylnaphthalene (CID 143588906) is butan-1-amine;1-methylnaphthalene.
What is the SMILES notation for butan-1-amine;1-methylnaphthalene?
The canonical SMILES for butan-1-amine;1-methylnaphthalene is CCCCN.Cc1cccc2ccccc12.
What is the InChIKey of butan-1-amine;1-methylnaphthalene?
The InChIKey is NPFJYAMPVZZPHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10.C4H11N/c1-9-5-4-7-10-6-2-3-8-11(9)10;1-2-3-4-5/h2-8H,1H3;2-5H2,1H3.
What are the key properties of butan-1-amine;1-methylnaphthalene?
butan-1-amine;1-methylnaphthalene has a molecular weight of 215.34 g/mol, XLogP of 3.89, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butan-1-amine;1-methylnaphthalene is sourced from PubChem (CID 143588906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).