About 1-butylnaphthalene;ethane
1-butylnaphthalene;ethane (PubChem CID 142087052) has the molecular formula C16H22
and a molecular weight of 214.35 g/mol. Its IUPAC name is 1-butylnaphthalene;ethane.
Molecular Properties
| Compound Name | 1-butylnaphthalene;ethane |
| PubChem CID | 142087052 |
| Molecular Formula | C16H22 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | 1-butylnaphthalene;ethane |
| SMILES | CC.CCCCc1cccc2ccccc12 |
| InChI | InChI=1S/C14H16.C2H6/c1-2-3-7-12-9-6-10-13-8-4-5-11-14(12)13;1-2/h4-6,8-11H,2-3,7H2,1H3;1-2H3 |
| InChIKey | QYZBFZWJHRHFAD-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-butylnaphthalene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butylnaphthalene;ethane?
The IUPAC name of 1-butylnaphthalene;ethane (CID 142087052) is 1-butylnaphthalene;ethane.
What is the SMILES notation for 1-butylnaphthalene;ethane?
The canonical SMILES for 1-butylnaphthalene;ethane is CC.CCCCc1cccc2ccccc12.
What is the InChIKey of 1-butylnaphthalene;ethane?
The InChIKey is QYZBFZWJHRHFAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16.C2H6/c1-2-3-7-12-9-6-10-13-8-4-5-11-14(12)13;1-2/h4-6,8-11H,2-3,7H2,1H3;1-2H3.
What are the key properties of 1-butylnaphthalene;ethane?
1-butylnaphthalene;ethane has a molecular weight of 214.35 g/mol, XLogP of 5.21, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butylnaphthalene;ethane is sourced from PubChem (CID 142087052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).