About 1-pentylnaphthalene;sulfuric acid
1-pentylnaphthalene;sulfuric acid (PubChem CID 172842201) has the molecular formula C15H20O4S
and a molecular weight of 296.39 g/mol. Its IUPAC name is 1-pentylnaphthalene;sulfuric acid.
Molecular Properties
| Compound Name | 1-pentylnaphthalene;sulfuric acid |
| PubChem CID | 172842201 |
| Molecular Formula | C15H20O4S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 1-pentylnaphthalene;sulfuric acid |
| SMILES | CCCCCc1cccc2ccccc12.O=S(=O)(O)O |
| InChI | InChI=1S/C15H18.H2O4S/c1-2-3-4-8-13-10-7-11-14-9-5-6-12-15(13)14;1-5(2,3)4/h5-7,9-12H,2-4,8H2,1H3;(H2,1,2,3,4) |
| InChIKey | WYCASBHJZXNOEX-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 1-pentylnaphthalene;sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pentylnaphthalene;sulfuric acid?
The IUPAC name of 1-pentylnaphthalene;sulfuric acid (CID 172842201) is 1-pentylnaphthalene;sulfuric acid.
What is the SMILES notation for 1-pentylnaphthalene;sulfuric acid?
The canonical SMILES for 1-pentylnaphthalene;sulfuric acid is CCCCCc1cccc2ccccc12.O=S(=O)(O)O.
What is the InChIKey of 1-pentylnaphthalene;sulfuric acid?
The InChIKey is WYCASBHJZXNOEX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18.H2O4S/c1-2-3-4-8-13-10-7-11-14-9-5-6-12-15(13)14;1-5(2,3)4/h5-7,9-12H,2-4,8H2,1H3;(H2,1,2,3,4).
What are the key properties of 1-pentylnaphthalene;sulfuric acid?
1-pentylnaphthalene;sulfuric acid has a molecular weight of 296.39 g/mol, XLogP of 3.92, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pentylnaphthalene;sulfuric acid is sourced from PubChem (CID 172842201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).