About potassium;hydride;1-octylnaphthalene
potassium;hydride;1-octylnaphthalene (PubChem CID 173443599) has the molecular formula C18H25K
and a molecular weight of 280.50 g/mol. Its IUPAC name is potassium;hydride;1-octylnaphthalene.
Molecular Properties
| Compound Name | potassium;hydride;1-octylnaphthalene |
| PubChem CID | 173443599 |
| Molecular Formula | C18H25K |
| Molecular Weight | 280.50 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | potassium;hydride;1-octylnaphthalene |
| SMILES | CCCCCCCCc1cccc2ccccc12.[H-].[K+] |
| InChI | InChI=1S/C18H24.K.H/c1-2-3-4-5-6-7-11-16-13-10-14-17-12-8-9-15-18(16)17;;/h8-10,12-15H,2-7,11H2,1H3;;/q;+1;-1 |
| InChIKey | GJQHFTGZLCZBRL-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 280.50 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze potassium;hydride;1-octylnaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;hydride;1-octylnaphthalene?
The IUPAC name of potassium;hydride;1-octylnaphthalene (CID 173443599) is potassium;hydride;1-octylnaphthalene.
What is the SMILES notation for potassium;hydride;1-octylnaphthalene?
The canonical SMILES for potassium;hydride;1-octylnaphthalene is CCCCCCCCc1cccc2ccccc12.[H-].[K+].
What is the InChIKey of potassium;hydride;1-octylnaphthalene?
The InChIKey is GJQHFTGZLCZBRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24.K.H/c1-2-3-4-5-6-7-11-16-13-10-14-17-12-8-9-15-18(16)17;;/h8-10,12-15H,2-7,11H2,1H3;;/q;+1;-1.
What are the key properties of potassium;hydride;1-octylnaphthalene?
potassium;hydride;1-octylnaphthalene has a molecular weight of 280.50 g/mol, XLogP of 2.86, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;hydride;1-octylnaphthalene is sourced from PubChem (CID 173443599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).