1-nonylnaphthalene;sulfuric acid

C19H28O4S — CID 172712573

IUPAC1-nonylnaphthalene;sulfuric acid
SMILESCCCCCCCCCc1cccc2ccccc12.O=S(=O)(O)O
InChIInChI=1S/C19H26.H2O4S/c1-2-3-4-5-6-7-8-12-17-14-11-15-18-13-9-10-16-19(17)18;1-5(2,3)4/h9-11,13-16H,2-8,12H2,1H3;(H2,1,2,3,4)
InChIKeyFLBSBJCECGLHCB-UHFFFAOYSA-N
MW352.50 g/mol
LogP5.48
Rot. Bonds8

About 1-nonylnaphthalene;sulfuric acid

1-nonylnaphthalene;sulfuric acid (PubChem CID 172712573) has the molecular formula C19H28O4S and a molecular weight of 352.50 g/mol. Its IUPAC name is 1-nonylnaphthalene;sulfuric acid.

Molecular Properties

Compound Name1-nonylnaphthalene;sulfuric acid
PubChem CID172712573
Molecular FormulaC19H28O4S
Molecular Weight352.50 g/mol
Exact Mass352.17
IUPAC Name1-nonylnaphthalene;sulfuric acid
SMILESCCCCCCCCCc1cccc2ccccc12.O=S(=O)(O)O
InChIInChI=1S/C19H26.H2O4S/c1-2-3-4-5-6-7-8-12-17-14-11-15-18-13-9-10-16-19(17)18;1-5(2,3)4/h9-11,13-16H,2-8,12H2,1H3;(H2,1,2,3,4)
InChIKeyFLBSBJCECGLHCB-UHFFFAOYSA-N
XLogP5.48
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds8
Heavy Atoms24
Complexity—

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500352.50
LogP ≤ 55.48
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 1-nonylnaphthalene;sulfuric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

1-octadecylnaphthalene;sulfuric acid
CID 172709808
1-nonylnaphthalene;sulfuric acid
CID 154996092
1-pentylnaphthalene;sulfuric acid
CID 172842201
sodium;hydride;1-nonylnaphthalene;sulfuric acid
CID 173181900
1-tetradecylnaphthalene
CID 14402128
potassium;hydride;1-octylnaphthalene
CID 173443599
3,8-didodecylnaphthalene-2-sulfonic acid
CID 101319611
1,2-di(pentadecyl)naphthalene;sulfuric acid
CID 172768972
5-hexylnaphthalene-2-sulfonic acid
CID 101315022
3,5-dihexylnaphthalene-2-sulfonic acid
CID 101319397
8-decylnaphthalene-2-sulfonic acid
CID 101315066
sulfuric acid;1,2,3-trihexadecylbenzene
CID 172861060

Frequently Asked Questions

What is the IUPAC name of 1-nonylnaphthalene;sulfuric acid?
The IUPAC name of 1-nonylnaphthalene;sulfuric acid (CID 172712573) is 1-nonylnaphthalene;sulfuric acid.
What is the SMILES notation for 1-nonylnaphthalene;sulfuric acid?
The canonical SMILES for 1-nonylnaphthalene;sulfuric acid is CCCCCCCCCc1cccc2ccccc12.O=S(=O)(O)O.
What is the InChIKey of 1-nonylnaphthalene;sulfuric acid?
The InChIKey is FLBSBJCECGLHCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26.H2O4S/c1-2-3-4-5-6-7-8-12-17-14-11-15-18-13-9-10-16-19(17)18;1-5(2,3)4/h9-11,13-16H,2-8,12H2,1H3;(H2,1,2,3,4).
What are the key properties of 1-nonylnaphthalene;sulfuric acid?
1-nonylnaphthalene;sulfuric acid has a molecular weight of 352.50 g/mol, XLogP of 5.48, 8 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-nonylnaphthalene;sulfuric acid is sourced from PubChem (CID 172712573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).