About azane;1-butylnaphthalene;methane
azane;1-butylnaphthalene;methane (PubChem CID 174691035) has the molecular formula C15H23N
and a molecular weight of 217.36 g/mol. Its IUPAC name is azane;1-butylnaphthalene;methane.
Molecular Properties
| Compound Name | azane;1-butylnaphthalene;methane |
| PubChem CID | 174691035 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | azane;1-butylnaphthalene;methane |
| SMILES | C.CCCCc1cccc2ccccc12.N |
| InChI | InChI=1S/C14H16.CH4.H3N/c1-2-3-7-12-9-6-10-13-8-4-5-11-14(12)13;;/h4-6,8-11H,2-3,7H2,1H3;1H4;1H3 |
| InChIKey | NQOOTSXHIVOYNG-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze azane;1-butylnaphthalene;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1-butylnaphthalene;methane?
The IUPAC name of azane;1-butylnaphthalene;methane (CID 174691035) is azane;1-butylnaphthalene;methane.
What is the SMILES notation for azane;1-butylnaphthalene;methane?
The canonical SMILES for azane;1-butylnaphthalene;methane is C.CCCCc1cccc2ccccc12.N.
What is the InChIKey of azane;1-butylnaphthalene;methane?
The InChIKey is NQOOTSXHIVOYNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16.CH4.H3N/c1-2-3-7-12-9-6-10-13-8-4-5-11-14(12)13;;/h4-6,8-11H,2-3,7H2,1H3;1H4;1H3.
What are the key properties of azane;1-butylnaphthalene;methane?
azane;1-butylnaphthalene;methane has a molecular weight of 217.36 g/mol, XLogP of 4.98, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1-butylnaphthalene;methane is sourced from PubChem (CID 174691035), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).