About methanamine;1-propylnaphthalene
methanamine;1-propylnaphthalene (PubChem CID 174438724) has the molecular formula C16H29N3
and a molecular weight of 263.43 g/mol. Its IUPAC name is methanamine;1-propylnaphthalene.
Molecular Properties
| Compound Name | methanamine;1-propylnaphthalene |
| PubChem CID | 174438724 |
| Molecular Formula | C16H29N3 |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.24 |
| IUPAC Name | methanamine;1-propylnaphthalene |
| SMILES | CCCc1cccc2ccccc12.CN.CN.CN |
| InChI | InChI=1S/C13H14.3CH5N/c1-2-6-11-8-5-9-12-7-3-4-10-13(11)12;3*1-2/h3-5,7-10H,2,6H2,1H3;3*2H2,1H3 |
| InChIKey | MBKOXXHSPDRZBY-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methanamine;1-propylnaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanamine;1-propylnaphthalene?
The IUPAC name of methanamine;1-propylnaphthalene (CID 174438724) is methanamine;1-propylnaphthalene.
What is the SMILES notation for methanamine;1-propylnaphthalene?
The canonical SMILES for methanamine;1-propylnaphthalene is CCCc1cccc2ccccc12.CN.CN.CN.
What is the InChIKey of methanamine;1-propylnaphthalene?
The InChIKey is MBKOXXHSPDRZBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14.3CH5N/c1-2-6-11-8-5-9-12-7-3-4-10-13(11)12;3*1-2/h3-5,7-10H,2,6H2,1H3;3*2H2,1H3.
What are the key properties of methanamine;1-propylnaphthalene?
methanamine;1-propylnaphthalene has a molecular weight of 263.43 g/mol, XLogP of 2.52, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanamine;1-propylnaphthalene is sourced from PubChem (CID 174438724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).