About azane;1-ethylnaphthalene
azane;1-ethylnaphthalene (PubChem CID 19048185) has the molecular formula C12H15N
and a molecular weight of 173.26 g/mol. Its IUPAC name is azane;1-ethylnaphthalene.
Molecular Properties
| Compound Name | azane;1-ethylnaphthalene |
| PubChem CID | 19048185 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | azane;1-ethylnaphthalene |
| SMILES | CCc1cccc2ccccc12.N |
| InChI | InChI=1S/C12H12.H3N/c1-2-10-7-5-8-11-6-3-4-9-12(10)11;/h3-9H,2H2,1H3;1H3 |
| InChIKey | KZHYDPGEAKPSOJ-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze azane;1-ethylnaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;1-ethylnaphthalene?
The IUPAC name of azane;1-ethylnaphthalene (CID 19048185) is azane;1-ethylnaphthalene.
What is the SMILES notation for azane;1-ethylnaphthalene?
The canonical SMILES for azane;1-ethylnaphthalene is CCc1cccc2ccccc12.N.
What is the InChIKey of azane;1-ethylnaphthalene?
The InChIKey is KZHYDPGEAKPSOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12.H3N/c1-2-10-7-5-8-11-6-3-4-9-12(10)11;/h3-9H,2H2,1H3;1H3.
What are the key properties of azane;1-ethylnaphthalene?
azane;1-ethylnaphthalene has a molecular weight of 173.26 g/mol, XLogP of 3.56, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azane;1-ethylnaphthalene is sourced from PubChem (CID 19048185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).