C24H24 — CID 158986916
1,2-dimethylnaphthalene;1-ethylnaphthalene (PubChem CID 158986916) has the molecular formula C24H24 and a molecular weight of 312.46 g/mol. Its IUPAC name is 1,2-dimethylnaphthalene;1-ethylnaphthalene.
| Compound Name | 1,2-dimethylnaphthalene;1-ethylnaphthalene |
|---|---|
| PubChem CID | 158986916 |
| Molecular Formula | C24H24 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.19 |
| IUPAC Name | 1,2-dimethylnaphthalene;1-ethylnaphthalene |
| SMILES | CCc1cccc2ccccc12.Cc1ccc2ccccc2c1C |
| InChI | InChI=1S/2C12H12/c1-9-7-8-11-5-3-4-6-12(11)10(9)2;1-2-10-7-5-8-11-6-3-4-9-12(10)11/h3-8H,1-2H3;3-9H,2H2,1H3 |
| InChIKey | JPRIYTLEWSCDGX-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |