C38H52 — CID 161084125
1,2-dimethylnaphthalene;2,3-dimethylnaphthalene;ethane;1,2-xylene (PubChem CID 161084125) has the molecular formula C38H52 and a molecular weight of 508.83 g/mol. Its IUPAC name is 1,2-dimethylnaphthalene;2,3-dimethylnaphthalene;ethane;1,2-xylene.
| Compound Name | 1,2-dimethylnaphthalene;2,3-dimethylnaphthalene;ethane;1,2-xylene |
|---|---|
| PubChem CID | 161084125 |
| Molecular Formula | C38H52 |
| Molecular Weight | 508.83 g/mol |
| Exact Mass | 508.41 |
| IUPAC Name | 1,2-dimethylnaphthalene;2,3-dimethylnaphthalene;ethane;1,2-xylene |
| SMILES | CC.CC.CC.Cc1cc2ccccc2cc1C.Cc1ccc2ccccc2c1C.Cc1ccccc1C |
| InChI | InChI=1S/2C12H12.C8H10.3C2H6/c1-9-7-11-5-3-4-6-12(11)8-10(9)2;1-9-7-8-11-5-3-4-6-12(11)10(9)2;1-7-5-3-4-6-8(7)2;3*1-2/h2*3-8H,1-2H3;3-6H,1-2H3;3*1-2H3 |
| InChIKey | UGGZWAJHXYRSSQ-UHFFFAOYSA-N |
| XLogP | 12.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.83 |
| LogP ≤ 5 | 12.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |