C20H16 — CID 154377924
3,4-dimethylbenzo[a]anthracene (PubChem CID 154377924) has the molecular formula C20H16 and a molecular weight of 256.35 g/mol. Its IUPAC name is 3,4-dimethylbenzo[a]anthracene.
| Compound Name | 3,4-dimethylbenzo[a]anthracene |
|---|---|
| PubChem CID | 154377924 |
| Molecular Formula | C20H16 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.13 |
| IUPAC Name | 3,4-dimethylbenzo[a]anthracene |
| SMILES | Cc1ccc2c(ccc3cc4ccccc4cc32)c1C |
| InChI | InChI=1S/C20H16/c1-13-7-9-19-18(14(13)2)10-8-17-11-15-5-3-4-6-16(15)12-20(17)19/h3-12H,1-2H3 |
| InChIKey | SRLWVSHOMGIRFP-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|