C46H38 — CID 159714317
9,10-dimethylanthracene;bis(9-methylanthracene) (PubChem CID 159714317) has the molecular formula C46H38 and a molecular weight of 590.81 g/mol. Its IUPAC name is 9,10-dimethylanthracene;bis(9-methylanthracene).
| Compound Name | 9,10-dimethylanthracene;bis(9-methylanthracene) |
|---|---|
| PubChem CID | 159714317 |
| Molecular Formula | C46H38 |
| Molecular Weight | 590.81 g/mol |
| Exact Mass | 590.30 |
| IUPAC Name | 9,10-dimethylanthracene;bis(9-methylanthracene) |
| SMILES | Cc1c2ccccc2c(C)c2ccccc12.Cc1c2ccccc2cc2ccccc12.Cc1c2ccccc2cc2ccccc12 |
| InChI | InChI=1S/C16H14.2C15H12/c1-11-13-7-3-5-9-15(13)12(2)16-10-6-4-8-14(11)16;2*1-11-14-8-4-2-6-12(14)10-13-7-3-5-9-15(11)13/h3-10H,1-2H3;2*2-10H,1H3 |
| InChIKey | MZFSEQJKPGDLGL-UHFFFAOYSA-N |
| XLogP | 13.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.81 |
| LogP ≤ 5 | 13.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|