About lithium;hydride;9-methylanthracene
lithium;hydride;9-methylanthracene (PubChem CID 174773747) has the molecular formula C15H13Li
and a molecular weight of 200.21 g/mol. Its IUPAC name is lithium;hydride;9-methylanthracene.
Molecular Properties
| Compound Name | lithium;hydride;9-methylanthracene |
| PubChem CID | 174773747 |
| Molecular Formula | C15H13Li |
| Molecular Weight | 200.21 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | lithium;hydride;9-methylanthracene |
| SMILES | Cc1c2ccccc2cc2ccccc12.[H-].[Li+] |
| InChI | InChI=1S/C15H12.Li.H/c1-11-14-8-4-2-6-12(14)10-13-7-3-5-9-15(11)13;;/h2-10H,1H3;;/q;+1;-1 |
| InChIKey | TXOAYWAPBLPOJU-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.21 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze lithium;hydride;9-methylanthracene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;hydride;9-methylanthracene?
The IUPAC name of lithium;hydride;9-methylanthracene (CID 174773747) is lithium;hydride;9-methylanthracene.
What is the SMILES notation for lithium;hydride;9-methylanthracene?
The canonical SMILES for lithium;hydride;9-methylanthracene is Cc1c2ccccc2cc2ccccc12.[H-].[Li+].
What is the InChIKey of lithium;hydride;9-methylanthracene?
The InChIKey is TXOAYWAPBLPOJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12.Li.H/c1-11-14-8-4-2-6-12(14)10-13-7-3-5-9-15(11)13;;/h2-10H,1H3;;/q;+1;-1.
What are the key properties of lithium;hydride;9-methylanthracene?
lithium;hydride;9-methylanthracene has a molecular weight of 200.21 g/mol, XLogP of 1.42, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;hydride;9-methylanthracene is sourced from PubChem (CID 174773747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).