About 9-methylanthracene;2-methylthiophene
9-methylanthracene;2-methylthiophene (PubChem CID 143060558) has the molecular formula C20H18S
and a molecular weight of 290.43 g/mol. Its IUPAC name is 9-methylanthracene;2-methylthiophene.
Molecular Properties
| Compound Name | 9-methylanthracene;2-methylthiophene |
| PubChem CID | 143060558 |
| Molecular Formula | C20H18S |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 9-methylanthracene;2-methylthiophene |
| SMILES | Cc1c2ccccc2cc2ccccc12.Cc1cccs1 |
| InChI | InChI=1S/C15H12.C5H6S/c1-11-14-8-4-2-6-12(14)10-13-7-3-5-9-15(11)13;1-5-3-2-4-6-5/h2-10H,1H3;2-4H,1H3 |
| InChIKey | JWOWSSRWVFXXRS-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 9-methylanthracene;2-methylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methylanthracene;2-methylthiophene?
The IUPAC name of 9-methylanthracene;2-methylthiophene (CID 143060558) is 9-methylanthracene;2-methylthiophene.
What is the SMILES notation for 9-methylanthracene;2-methylthiophene?
The canonical SMILES for 9-methylanthracene;2-methylthiophene is Cc1c2ccccc2cc2ccccc12.Cc1cccs1.
What is the InChIKey of 9-methylanthracene;2-methylthiophene?
The InChIKey is JWOWSSRWVFXXRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12.C5H6S/c1-11-14-8-4-2-6-12(14)10-13-7-3-5-9-15(11)13;1-5-3-2-4-6-5/h2-10H,1H3;2-4H,1H3.
What are the key properties of 9-methylanthracene;2-methylthiophene?
9-methylanthracene;2-methylthiophene has a molecular weight of 290.43 g/mol, XLogP of 6.36, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methylanthracene;2-methylthiophene is sourced from PubChem (CID 143060558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).