C80H70 — CID 159448602
2,6-dimethylanthracene;bis(2,9-dimethylanthracene);bis(2,10-dimethylanthracene) (PubChem CID 159448602) has the molecular formula C80H70 and a molecular weight of 1031.44 g/mol. Its IUPAC name is 2,6-dimethylanthracene;bis(2,9-dimethylanthracene);bis(2,10-dimethylanthracene).
| Compound Name | 2,6-dimethylanthracene;bis(2,9-dimethylanthracene);bis(2,10-dimethylanthracene) |
|---|---|
| PubChem CID | 159448602 |
| Molecular Formula | C80H70 |
| Molecular Weight | 1031.44 g/mol |
| Exact Mass | 1030.55 |
| IUPAC Name | 2,6-dimethylanthracene;bis(2,9-dimethylanthracene);bis(2,10-dimethylanthracene) |
| SMILES | Cc1ccc2c(C)c3ccccc3cc2c1.Cc1ccc2c(C)c3ccccc3cc2c1.Cc1ccc2cc3cc(C)ccc3cc2c1.Cc1ccc2cc3ccccc3c(C)c2c1.Cc1ccc2cc3ccccc3c(C)c2c1 |
| InChI | InChI=1S/5C16H14/c1-11-3-5-13-10-16-8-12(2)4-6-14(16)9-15(13)7-11;2*1-11-7-8-16-12(2)15-6-4-3-5-13(15)10-14(16)9-11;2*1-11-7-8-14-10-13-5-3-4-6-15(13)12(2)16(14)9-11/h5*3-10H,1-2H3 |
| InChIKey | LTBQLTGNWGYWIO-UHFFFAOYSA-N |
| XLogP | 23.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 80 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1031.44 |
| LogP ≤ 5 | 23.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|