C82H96 — CID 161265902
1,4-dimethylanthracene;2,6-dimethylanthracene;9,10-dimethylanthracene;2,3-dimethylnaphthalene;2,7-dimethylnaphthalene;ethane (PubChem CID 161265902) has the molecular formula C82H96 and a molecular weight of 1081.67 g/mol. Its IUPAC name is 1,4-dimethylanthracene;2,6-dimethylanthracene;9,10-dimethylanthracene;2,3-dimethylnaphthalene;2,7-dimethylnaphthalene;ethane.
| Compound Name | 1,4-dimethylanthracene;2,6-dimethylanthracene;9,10-dimethylanthracene;2,3-dimethylnaphthalene;2,7-dimethylnaphthalene;ethane |
|---|---|
| PubChem CID | 161265902 |
| Molecular Formula | C82H96 |
| Molecular Weight | 1081.67 g/mol |
| Exact Mass | 1080.75 |
| IUPAC Name | 1,4-dimethylanthracene;2,6-dimethylanthracene;9,10-dimethylanthracene;2,3-dimethylnaphthalene;2,7-dimethylnaphthalene;ethane |
| SMILES | CC.CC.CC.CC.CC.Cc1c2ccccc2c(C)c2ccccc12.Cc1cc2ccccc2cc1C.Cc1ccc(C)c2cc3ccccc3cc12.Cc1ccc2cc3cc(C)ccc3cc2c1.Cc1ccc2ccc(C)cc2c1 |
| InChI | InChI=1S/3C16H14.2C12H12.5C2H6/c1-11-3-5-13-10-16-8-12(2)4-6-14(16)9-15(13)7-11;1-11-13-7-3-5-9-15(13)12(2)16-10-6-4-8-14(11)16;1-11-7-8-12(2)16-10-14-6-4-3-5-13(14)9-15(11)16;1-9-3-5-11-6-4-10(2)8-12(11)7-9;1-9-7-11-5-3-4-6-12(11)8-10(9)2;5*1-2/h3*3-10H,1-2H3;2*3-8H,1-2H3;5*1-2H3 |
| InChIKey | VDEJKDGEQWVRBV-UHFFFAOYSA-N |
| XLogP | 25.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 82 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1081.67 |
| LogP ≤ 5 | 25.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|