C18H20 — CID 142009331
1,6-dimethylanthracene;ethane (PubChem CID 142009331) has the molecular formula C18H20 and a molecular weight of 236.36 g/mol. Its IUPAC name is 1,6-dimethylanthracene;ethane.
| Compound Name | 1,6-dimethylanthracene;ethane |
|---|---|
| PubChem CID | 142009331 |
| Molecular Formula | C18H20 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 1,6-dimethylanthracene;ethane |
| SMILES | CC.Cc1ccc2cc3c(C)cccc3cc2c1 |
| InChI | InChI=1S/C16H14.C2H6/c1-11-6-7-13-10-16-12(2)4-3-5-14(16)9-15(13)8-11;1-2/h3-10H,1-2H3;1-2H3 |
| InChIKey | UORIDUXUQPRXOP-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|