C12H13Br — CID 174429192
1,2-dimethylnaphthalene;hydrobromide (PubChem CID 174429192) has the molecular formula C12H13Br and a molecular weight of 237.14 g/mol. Its IUPAC name is 1,2-dimethylnaphthalene;hydrobromide.
| Compound Name | 1,2-dimethylnaphthalene;hydrobromide |
|---|---|
| PubChem CID | 174429192 |
| Molecular Formula | C12H13Br |
| Molecular Weight | 237.14 g/mol |
| Exact Mass | 236.02 |
| IUPAC Name | 1,2-dimethylnaphthalene;hydrobromide |
| SMILES | Br.Cc1ccc2ccccc2c1C |
| InChI | InChI=1S/C12H12.BrH/c1-9-7-8-11-5-3-4-6-12(11)10(9)2;/h3-8H,1-2H3;1H |
| InChIKey | VIBIPYWHMGLVPR-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.14 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |