About 1,2-dimethylnaphthalene;ethane
1,2-dimethylnaphthalene;ethane (PubChem CID 90922397) has the molecular formula C16H24
and a molecular weight of 216.37 g/mol. Its IUPAC name is 1,2-dimethylnaphthalene;ethane.
Molecular Properties
| Compound Name | 1,2-dimethylnaphthalene;ethane |
| PubChem CID | 90922397 |
| Molecular Formula | C16H24 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.19 |
| IUPAC Name | 1,2-dimethylnaphthalene;ethane |
| SMILES | CC.CC.Cc1ccc2ccccc2c1C |
| InChI | InChI=1S/C12H12.2C2H6/c1-9-7-8-11-5-3-4-6-12(11)10(9)2;2*1-2/h3-8H,1-2H3;2*1-2H3 |
| InChIKey | VUUWXUICEUAXRE-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,2-dimethylnaphthalene;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethylnaphthalene;ethane?
The IUPAC name of 1,2-dimethylnaphthalene;ethane (CID 90922397) is 1,2-dimethylnaphthalene;ethane.
What is the SMILES notation for 1,2-dimethylnaphthalene;ethane?
The canonical SMILES for 1,2-dimethylnaphthalene;ethane is CC.CC.Cc1ccc2ccccc2c1C.
What is the InChIKey of 1,2-dimethylnaphthalene;ethane?
The InChIKey is VUUWXUICEUAXRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12.2C2H6/c1-9-7-8-11-5-3-4-6-12(11)10(9)2;2*1-2/h3-8H,1-2H3;2*1-2H3.
What are the key properties of 1,2-dimethylnaphthalene;ethane?
1,2-dimethylnaphthalene;ethane has a molecular weight of 216.37 g/mol, XLogP of 5.51, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethylnaphthalene;ethane is sourced from PubChem (CID 90922397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).